EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O3 |
| Net Charge | 0 |
| Average Mass | 174.200 |
| Monoisotopic Mass | 174.10044 |
| SMILES | CC(=O)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H14N2O3/c1-5(10)9-4-2-3-6(8)7(11)12/h6H,2-4,8H2,1H3,(H,9,10)(H,11,12)/t6-/m0/s1 |
| InChIKey | SRXKAYJJGAAOBP-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-acetyl-L-ornithine (CHEBI:44673) is a N5-acetylornithine (CHEBI:133179) |
| N5-acetyl-L-ornithine (CHEBI:44673) is a N5-acyl-L-ornithine (CHEBI:17339) |
| N5-acetyl-L-ornithine (CHEBI:44673) is a acetyl-L-ornithine (CHEBI:86496) |
| IUPAC Name |
|---|
| N5-acetyl-L-ornithine |
| Synonyms | Source |
|---|---|
| N(5)-Acetyl-L-ornithine | ChemIDplus |
| N(delta)-Acetylornithine | ChemIDplus |