EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N6O |
| Net Charge | 0 |
| Average Mass | 298.350 |
| Monoisotopic Mass | 298.15421 |
| SMILES | Cn1cnc2c(NCc3ccccc3)nc(NCCO)nc21 |
| InChI | InChI=1S/C15H18N6O/c1-21-10-18-12-13(17-9-11-5-3-2-4-6-11)19-15(16-7-8-22)20-14(12)21/h2-6,10,22H,7-9H2,1H3,(H2,16,17,19,20) |
| InChIKey | GTVPOLSIJWJJNY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olomoucine (CHEBI:44661) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| olomoucine (CHEBI:44661) is a 2,6-diaminopurines (CHEBI:38001) |
| olomoucine (CHEBI:44661) is a ethanolamines (CHEBI:23981) |
| IUPAC Name |
|---|
| 2-{[6-(benzylamino)-9-methyl-9H-purin-2-yl]amino}ethanol |
| Synonyms | Source |
|---|---|
| 2-(hydroxyethylamino)-6-benzylamino-9-methylpurine | ChEBI |
| 6-(benzylamino)-2-(2-hydroxyethylamino)-9-methylpurine | ChEBI |
| 2-[[9-methyl-6-[(phenylmethyl)amino]-9H-purin-2-yl]amino]-ethanol | ChEBI |
| 2-{[6-(benzylamino)-9-methyl-9H-purin-2-yl]amino}ethan-1-ol | IUPAC |
| 2-(2-hydroxyethylamino)-6-(benzylamino)-9-methylpurine | ChemIDplus |
| olomucine | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:101622-51-9 | ChemIDplus |
| Citations |
|---|