EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31FO6 |
| Net Charge | 0 |
| Average Mass | 434.504 |
| Monoisotopic Mass | 434.21047 |
| SMILES | [H][C@@]12C[C@@H](C)[C@](O)(C(=O)COC(C)=O)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C24H31FO6/c1-13-9-18-17-6-5-15-10-16(27)7-8-21(15,3)23(17,25)19(28)11-22(18,4)24(13,30)20(29)12-31-14(2)26/h7-8,10,13,17-19,28,30H,5-6,9,11-12H2,1-4H3/t13-,17+,18+,19+,21+,22+,23+,24+/m1/s1 |
| InChIKey | AKUJBENLRBOFTD-RPRRAYFGSA-N |
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dexamethasone acetate (CHEBI:4463) has role antineoplastic agent (CHEBI:35610) |
| Dexamethasone acetate (CHEBI:4463) is a corticosteroid hormone (CHEBI:36699) |
| Synonyms | Source |
|---|---|
| decadronal | DrugCentral |
| Dectancyl | ChEMBL |
| Dexamethasone 21-acetate | ChEMBL |
| Dexamethasone acetate | ChEMBL |
| Dexamethasone acetate anhydrous | KEGG COMPOUND |
| Dexamethasone acetate monohydrate | ChEMBL |
| Brand Name | Source |
|---|---|
| Decadron-la | ChEMBL |
| Citations |
|---|