EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29NO2 |
| Net Charge | 0 |
| Average Mass | 387.523 |
| Monoisotopic Mass | 387.21983 |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCN(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H29NO2/c1-4-25(20-8-6-5-7-9-20)26(21-10-14-23(28)15-11-21)22-12-16-24(17-13-22)29-19-18-27(2)3/h5-17,28H,4,18-19H2,1-3H3/b26-25- |
| InChIKey | TXUZVZSFRXZGTL-QPLCGJKRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. estrogen receptor antagonist An antagonist at the estrogen receptor. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. estrogen receptor antagonist An antagonist at the estrogen receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| afimoxifene (CHEBI:44616) has functional parent tamoxifen (CHEBI:41774) |
| afimoxifene (CHEBI:44616) has role antineoplastic agent (CHEBI:35610) |
| afimoxifene (CHEBI:44616) has role estrogen receptor antagonist (CHEBI:50792) |
| afimoxifene (CHEBI:44616) has role metabolite (CHEBI:25212) |
| afimoxifene (CHEBI:44616) is a phenols (CHEBI:33853) |
| afimoxifene (CHEBI:44616) is a tertiary amino compound (CHEBI:50996) |
| INN | Source |
|---|---|
| afimoxifene | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-hydroxytamoxifen | ChemIDplus |
| 4-Hydroxytamoxifen | KEGG COMPOUND |
| 4-HYDROXYTAMOXIFEN | PDBeChem |
| 4-monohydroxytamoxifen | ChEBI |
| 4-OHT | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Afimoxifene | Wikipedia |
| C05011 | KEGG COMPOUND |
| D06551 | KEGG DRUG |
| OHT | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4910748 | Reaxys |
| CAS:68047-06-3 | KEGG COMPOUND |
| CAS:68392-35-8 | ChemIDplus |
| Citations |
|---|