EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19N3O7 |
| Net Charge | 0 |
| Average Mass | 353.331 |
| Monoisotopic Mass | 353.12230 |
| SMILES | CC(=O)N[C@H]1/C(=N/OC(=O)Nc2ccccc2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H19N3O7/c1-8(20)16-11-13(22)12(21)10(7-19)24-14(11)18-25-15(23)17-9-5-3-2-4-6-9/h2-6,10-13,19,21-22H,7H2,1H3,(H,16,20)(H,17,23)/b18-14-/t10-,11-,12-,13-/m1/s1 |
| InChIKey | PBLNJFVQMUMOJY-JXZOILRNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.2.1.52 (beta-N-acetylhexosaminidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of β-N-acetylhexosaminidase (EC 3.2.1.52). |
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-PUGNAc (CHEBI:44601) has role cardioprotective agent (CHEBI:77307) |
| (Z)-PUGNAc (CHEBI:44601) has role EC 3.2.1.52 (β-N-acetylhexosaminidase) inhibitor (CHEBI:184301) |
| (Z)-PUGNAc (CHEBI:44601) is a PUGNAc (CHEBI:233425) |
| IUPAC Name |
|---|
| N-[(2Z,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-{[(phenylcarbamoyl)oxy]imino}tetrahydro-2H-pyran-3-yl]acetamide |
| Synonyms | Source |
|---|---|
| O-(2-acetamido-2-deoxy-D-glucopyranosylidene)amino-N-phenylcarbamate | PDBeChem |
| PUGNAc | ChEBI |
| O-(2-acetamido-2-deoxy-D-glucopyranosylidenamino) N-phenylcarbamate | ChEBI |
| [(2Z,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-ylidene]amino N-phenylcarbamate | ChEBI |
| (Z)-PUGNAc | ChEBI |
| N-acetyl-glucosaminono-1,5-lactone O-(phenylcarbamoyl)-(Z)-oxime | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| OAN | PDBeChem |
| HMDB0256921 | HMDB |
| PUGNAc | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:132489-69-1 | ChEBI |
| Citations |
|---|