EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:44598 - 5-({4-[2-(1-oxidopiperidin-1-yl)ethyl]phenyl}amino)-5-oxopentanoic acid
| Formula | C18H26N2O4 |
| Net Charge | 0 |
| Average Mass | 334.416 |
| Monoisotopic Mass | 334.18926 |
| SMILES | O=C(O)CCCC(=O)Nc1ccc(CC[N+]2([O-])CCCCC2)cc1 |
| InChI | InChI=1S/C18H26N2O4/c21-17(5-4-6-18(22)23)19-16-9-7-15(8-10-16)11-14-20(24)12-2-1-3-13-20/h7-10H,1-6,11-14H2,(H,19,21)(H,22,23) |
| InChIKey | RKJXWOJUCCBWSC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-({4-[2-(1-oxidopiperidin-1-yl)ethyl]phenyl}amino)-5-oxopentanoic acid (CHEBI:44598) has functional parent glutaric acid (CHEBI:17859) |
| 5-({4-[2-(1-oxidopiperidin-1-yl)ethyl]phenyl}amino)-5-oxopentanoic acid (CHEBI:44598) has role epitope (CHEBI:53000) |
| 5-({4-[2-(1-oxidopiperidin-1-yl)ethyl]phenyl}amino)-5-oxopentanoic acid (CHEBI:44598) is a dicarboxylic acid monoamide (CHEBI:35735) |
| 5-({4-[2-(1-oxidopiperidin-1-yl)ethyl]phenyl}amino)-5-oxopentanoic acid (CHEBI:44598) is a piperidine N-oxide (CHEBI:48724) |
| IUPAC Name |
|---|
| 5-({4-[2-(1-oxidopiperidin-1-yl)ethyl]phenyl}amino)-5-oxopentanoic acid |
| Citations |
|---|