EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6N2O2 |
| Net Charge | 0 |
| Average Mass | 138.126 |
| Monoisotopic Mass | 138.04293 |
| SMILES | Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C6H6N2O2/c7-5-1-3-6(4-2-5)8(9)10/h1-4H,7H2 |
| InChIKey | TYMLOMAKGOJONV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-nitroaniline (CHEBI:17064) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 4-nitroaniline (CHEBI:17064) is a nitroaniline (CHEBI:25550) |
| Incoming Relation(s) |
| N-(p-nitrophenyl)-β-alaninamide (CHEBI:90126) has functional parent 4-nitroaniline (CHEBI:17064) |
| 5-{[4-({hydroxy[(4-nitrophenyl)amino]phosphoryl}methyl)phenyl]amino}-5-oxopentanoic acid (CHEBI:63478) has functional parent 4-nitroaniline (CHEBI:17064) |
| NS-398 (CHEBI:73458) has functional parent 4-nitroaniline (CHEBI:17064) |
| IUPAC Name |
|---|
| 4-nitroaniline |
| Synonyms | Source |
|---|---|
| 4-Nitroaniline | KEGG COMPOUND |
| p-Nitroaniline | KEGG COMPOUND |
| 4-Nitrobenzeneamine | KEGG COMPOUND |
| 1-amino-4-nitrobenzene | NIST Chemistry WebBook |
| 4-nitraniline | NIST Chemistry WebBook |
| p-aminonitrobenzene | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 4-nitroaniline | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02126 | KEGG COMPOUND |
| C02126 | KEGG COMPOUND |
| NIT | PDBeChem |
| 4-NITROANILINE | MetaCyc |
| 4-Nitroaniline | Wikipedia |
| Citations |
|---|