EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O |
| Net Charge | 0 |
| Average Mass | 310.481 |
| Monoisotopic Mass | 310.22967 |
| SMILES | [H][C@@]12CC[C@@](O)(C#C)[C@@]1(CC)CC(=C)[C@@]1([H])[C@@]2([H])CCC2=CCCC[C@@]21[H] |
| InChI | InChI=1S/C22H30O/c1-4-21-14-15(3)20-17-9-7-6-8-16(17)10-11-18(20)19(21)12-13-22(21,23)5-2/h2,8,17-20,23H,3-4,6-7,9-14H2,1H3/t17-,18-,19-,20+,21-,22-/m0/s1 |
| InChIKey | RPLCPCMSCLEKRS-BPIQYHPVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | progestin A synthetic progestogen. |
| Applications: | synthetic oral contraceptive An oral contraceptive which owes its effectiveness to synthetic preparation. contraceptive drug A chemical substance that prevents or reduces the probability of conception. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desogestrel (CHEBI:4453) has role contraceptive drug (CHEBI:49323) |
| desogestrel (CHEBI:4453) has role progestin (CHEBI:59826) |
| desogestrel (CHEBI:4453) has role synthetic oral contraceptive (CHEBI:49326) |
| desogestrel (CHEBI:4453) is a 17β-hydroxy steroid (CHEBI:35343) |
| desogestrel (CHEBI:4453) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| 17α-ethynyl-11-methylidene-18a-homo-estr-4-en-17β-ol |
| INNs | Source |
|---|---|
| desogestrel | ChEBI |
| desogestrelum | ChEBI |
| désogestrel | ChEBI |
| Synonym | Source |
|---|---|
| 13-Ethyl-11-methylene-18,19-dinor-17α-pregn-4-en-20-yn-17-ol | ChemIDplus |
| Brand Name | Source |
|---|---|
| Cerazette | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| C07629 | KEGG COMPOUND |
| DB00304 | DrugBank |
| D02367 | KEGG DRUG |
| DE2361120 | Patent |
| US3927046 | Patent |
| LMST02030104 | LIPID MAPS |
| Desogestrel | Wikipedia |
| 818 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5094648 | Beilstein |
| CAS:54024-22-5 | ChemIDplus |