EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO3 |
| Net Charge | 0 |
| Average Mass | 133.147 |
| Monoisotopic Mass | 133.07389 |
| SMILES | CO[C@H](C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO3/c1-3(9-2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t3-,4+/m1/s1 |
| InChIKey | FYCWLJLGIAUCCL-DMTCNVIQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | bleaching agent A reagent that lightens or whitens a substrate through chemical reaction. Bleaching reactions usually involve oxidative or reductive processes that degrade colour systems. Bleaching can occur by destroying one or more of the double bonds in the conjugated chain, by cleaving the conjugated chain, or by oxidation of one of the other moieties in the conjugated chain. Their reactivity results in many bleaches having strong bactericidal, disinfecting, and sterilising properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-methyl-L-threonine (CHEBI:44514) has role antibacterial agent (CHEBI:33282) |
| O-methyl-L-threonine (CHEBI:44514) has role bleaching agent (CHEBI:132717) |
| O-methyl-L-threonine (CHEBI:44514) is a L-threonine derivative (CHEBI:84189) |
| O-methyl-L-threonine (CHEBI:44514) is a ether (CHEBI:25698) |
| O-methyl-L-threonine (CHEBI:44514) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| O-methyl-L-threonine residue (CHEBI:167628) is substituent group from O-methyl-L-threonine (CHEBI:44514) |
| IUPAC Name |
|---|
| O-methyl-L-threonine |
| Synonyms | Source |
|---|---|
| (2S,3R)-2-amino-3-methoxybutanoic acid | IUPAC |
| (2S,3R)-2-amino-3-methoxybutyric acid | ChEBI |
| O-methyl threonine | ChEBI |
| O-methyl-threonine | ChEBI |
| O-methylthreonine | ChemIDplus |
| H-Thr(Me)-OH | ChEBI |
| Citations |
|---|