EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O3 |
| Net Charge | 0 |
| Average Mass | 132.159 |
| Monoisotopic Mass | 132.07864 |
| SMILES | CC(C)C[C@H](O)C(=O)O |
| InChI | InChI=1S/C6H12O3/c1-4(2)3-5(7)6(8)9/h4-5,7H,3H2,1-2H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | LVRFTAZAXQPQHI-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-hydroxy-4-methylpentanoic acid (CHEBI:44510) is a (2S)-2-hydroxy monocarboxylic acid (CHEBI:17375) |
| (S)-2-hydroxy-4-methylpentanoic acid (CHEBI:44510) is a 2-hydroxy-4-methylvaleric acid (CHEBI:59783) |
| (S)-2-hydroxy-4-methylpentanoic acid (CHEBI:44510) is enantiomer of (R)-2-hydroxy-4-methylpentanoic acid (CHEBI:55534) |
| Incoming Relation(s) |
| (R)-2-hydroxy-4-methylpentanoic acid (CHEBI:55534) is enantiomer of (S)-2-hydroxy-4-methylpentanoic acid (CHEBI:44510) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-4-methylpentanoic acid |
| Synonyms | Source |
|---|---|
| 2-HYDROXY-4-METHYL-PENTANOIC ACID | PDBeChem |
| L-2-Hydroxy-4-methylvaleric acid | ChemIDplus |
| (+)-α-Hydroxyisocaproic acid | ChEBI |
| (S)-2-hydroxyisocaproic acid | ChEBI |
| L-α-hydroxyisocaproic acid | ChEBI |
| L-2-hydroxy-4-methylvaleric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1721732 | Beilstein |
| Gmelin:1218577 | Gmelin |
| CAS:13748-90-8 | ChemIDplus |
| Citations |
|---|