EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H49NO16 |
| Net Charge | 0 |
| Average Mass | 787.812 |
| Monoisotopic Mass | 787.30513 |
| SMILES | [H][C@@]12Oc3c(cc(O)c4c3C(=O)c3cc5c(c(O)c3C4=O)[C@@H](O[C@@H]3O[C@@H](C)[C@H](OC)[C@@](C)(OC)[C@H]3OC)C[C@](C)(O)[C@@H]5C(=O)OC)[C@@](C)(O1)[C@H](O)[C@@H](N(C)C)[C@@H]2O |
| InChI | InChI=1S/C39H49NO16/c1-14-32(49-7)39(4,52-10)33(50-8)36(53-14)54-19-13-37(2,48)24(34(47)51-9)15-11-16-21(27(43)20(15)19)28(44)22-18(41)12-17-30(23(22)26(16)42)55-35-29(45)25(40(5)6)31(46)38(17,3)56-35/h11-12,14,19,24-25,29,31-33,35-36,41,43,45-46,48H,13H2,1-10H3/t14-,19-,24-,25-,29-,31+,32-,33-,35+,36-,37-,38+,39+/m0/s1 |
| InChIKey | KGTDRFCXGRULNK-JYOBTZKQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces nogalater (ncbitaxon:38314) | - | PubMed (22073550) | Strain: Lv65 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | cardiotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the heart and cardiomyocytes. intercalator A role played by a chemical agent which exhibits the capability of occupying space between DNA base pairs due to particular properties in size, shape and charge. Intercalation of chemical compounds in DNA helix can result in replication errors (shift, mutation) or DNA damages. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nogalamycin (CHEBI:44504) has role antineoplastic agent (CHEBI:35610) |
| nogalamycin (CHEBI:44504) has role bacterial metabolite (CHEBI:76969) |
| nogalamycin (CHEBI:44504) has role cardiotoxic agent (CHEBI:50912) |
| nogalamycin (CHEBI:44504) has role intercalator (CHEBI:24853) |
| nogalamycin (CHEBI:44504) is a anthracycline antibiotic (CHEBI:49322) |
| nogalamycin (CHEBI:44504) is a methyl ester (CHEBI:25248) |
| nogalamycin (CHEBI:44504) is a monosaccharide derivative (CHEBI:63367) |
| nogalamycin (CHEBI:44504) is a organic heterohexacyclic compound (CHEBI:51914) |
| nogalamycin (CHEBI:44504) is a polyketide (CHEBI:26188) |
| nogalamycin (CHEBI:44504) is a tertiary amino compound (CHEBI:50996) |
| nogalamycin (CHEBI:44504) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| methyl (2R,3S,4R,5R,6R,11S,13S,14R)-11-[(6-deoxy-3-C-methyl-2,3,4-tri-O-methyl-α-L-mannopyranosyl)oxy]-4-(dimethylamino)-3,5,8,10,13-pentahydroxy-6,13-dimethyl-9,16-dioxo-3,4,5,6,9,11,12,13,14,16-decahydro-2H-2,6-epoxytetraceno[1,2-b]oxocine-14-carboxylate |
| INNs | Source |
|---|---|
| nogalamicina | WHO MedNet |
| nogalamycin | WHO MedNet |
| nogalamycine | WHO MedNet |
| nogalamycinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| antibiotic 205t3 | ChemIDplus |
| U 15167 | ChemIDplus |
| U-15167 | ChemIDplus |
| Citations |
|---|