EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H64N14O12S2 |
| Net Charge | 0 |
| Average Mass | 1069.238 |
| Monoisotopic Mass | 1068.42696 |
| SMILES | N=C(N)NCCC[C@@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CSSCCC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N1)C(=O)NCC(N)=O |
| InChI | InChI=1S/C46H64N14O12S2/c47-35(62)15-14-29-40(67)58-32(22-36(48)63)43(70)59-33(45(72)60-18-5-9-34(60)44(71)56-28(8-4-17-52-46(50)51)39(66)53-23-37(49)64)24-74-73-19-16-38(65)54-30(21-26-10-12-27(61)13-11-26)41(68)57-31(42(69)55-29)20-25-6-2-1-3-7-25/h1-3,6-7,10-13,28-34,61H,4-5,8-9,14-24H2,(H2,47,62)(H2,48,63)(H2,49,64)(H,53,66)(H,54,65)(H,55,69)(H,56,71)(H,57,68)(H,58,67)(H,59,70)(H4,50,51,52)/t28-,29+,30+,31+,32+,33+,34+/m1/s1 |
| InChIKey | NFLWUMRGJYTJIN-PNIOQBSNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | vasopressin receptor agonist Any drug which binds to vasopressin receptors and triggers a response. |
| Applications: | diagnostic agent A substance administered to aid diagnosis of a disease. renal agent A drug used for its effect on the kidneys' regulation of body fluid composition and volume. vasopressin receptor agonist Any drug which binds to vasopressin receptors and triggers a response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desmopressin (CHEBI:4450) has role diagnostic agent (CHEBI:33295) |
| desmopressin (CHEBI:4450) has role renal agent (CHEBI:35846) |
| desmopressin (CHEBI:4450) has role vasopressin receptor agonist (CHEBI:59727) |
| desmopressin (CHEBI:4450) is a heterodetic cyclic peptide (CHEBI:24533) |
| Incoming Relation(s) |
| desmopressin acetate (anhydrous) (CHEBI:59726) has part desmopressin (CHEBI:4450) |
| IUPAC Name |
|---|
| 1-{[(4R,7S,10S,13S,16S)-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-benzyl-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-D-arginylglycinamide |
| INNs | Source |
|---|---|
| desmopresina | ChemIDplus |
| desmopressinum | ChemIDplus |
| desmopressine | ChemIDplus |
| desmopressin | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-deamino-8-D-arginine vasopressin | ChemIDplus |
| 1-desamino-8-D-arginine vasopressin | ChemIDplus |
| 1-(3-mercaptopropionic acid)-8-D-arginine-vasopressin | ChEBI |
| DDAVP | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4651966 | Beilstein |
| CAS:16679-58-6 | KEGG COMPOUND |
| CAS:16679-58-6 | ChemIDplus |