EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:44499 - methyl nonanoate
| Formula | C10H20O2 |
| Net Charge | 0 |
| Average Mass | 172.268 |
| Monoisotopic Mass | 172.14633 |
| SMILES | CCCCCCCCC(=O)OC |
| InChI | InChI=1S/C10H20O2/c1-3-4-5-6-7-8-9-10(11)12-2/h3-9H2,1-2H3 |
| InChIKey | IJXHLVMUNBOGRR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. antinematodal drug A substance used in the treatment or control of nematode infestations. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl nonanoate (CHEBI:44499) has functional parent methanol (CHEBI:17790) |
| methyl nonanoate (CHEBI:44499) has functional parent nonanoic acid (CHEBI:29019) |
| methyl nonanoate (CHEBI:44499) has role antifungal agent (CHEBI:35718) |
| methyl nonanoate (CHEBI:44499) has role antinematodal drug (CHEBI:35444) |
| methyl nonanoate (CHEBI:44499) has role epitope (CHEBI:53000) |
| methyl nonanoate (CHEBI:44499) has role fragrance (CHEBI:48318) |
| methyl nonanoate (CHEBI:44499) has role plant metabolite (CHEBI:76924) |
| methyl nonanoate (CHEBI:44499) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl nonanoate |
| Synonyms | Source |
|---|---|
| Methyl pelargonate | ChemIDplus |
| Methyl nonylate | ChemIDplus |
| Methyl ester nonanoic acid | NIST Chemistry WebBook |
| Methyl n-nonanoate | NIST Chemistry WebBook |
| Pelargonic acid methyl ester | NIST Chemistry WebBook |
| Citations |
|---|