EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:44499 - methyl nonanoate
| Formula | C10H20O2 |
| Net Charge | 0 |
| Average Mass | 172.268 |
| Monoisotopic Mass | 172.14633 |
| SMILES | CCCCCCCCC(=O)OC |
| InChI | InChI=1S/C10H20O2/c1-3-4-5-6-7-8-9-10(11)12-2/h3-9H2,1-2H3 |
| InChIKey | IJXHLVMUNBOGRR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antinematodal drug A substance used in the treatment or control of nematode infestations. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl nonanoate (CHEBI:44499) has functional parent methanol (CHEBI:17790) |
| methyl nonanoate (CHEBI:44499) has functional parent nonanoic acid (CHEBI:29019) |
| methyl nonanoate (CHEBI:44499) has role antifungal agent (CHEBI:35718) |
| methyl nonanoate (CHEBI:44499) has role antinematodal drug (CHEBI:35444) |
| methyl nonanoate (CHEBI:44499) has role epitope (CHEBI:53000) |
| methyl nonanoate (CHEBI:44499) has role fragrance (CHEBI:48318) |
| methyl nonanoate (CHEBI:44499) has role plant metabolite (CHEBI:76924) |
| methyl nonanoate (CHEBI:44499) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl nonanoate |
| Synonyms | Source |
|---|---|
| Methyl ester nonanoic acid | NIST Chemistry WebBook |
| Methyl n-nonanoate | NIST Chemistry WebBook |
| Methyl nonylate | ChemIDplus |
| Methyl pelargonate | ChemIDplus |
| Pelargonic acid methyl ester | NIST Chemistry WebBook |
| Citations |
|---|