EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:44491 |
| ChEBI Name | 4-({5-[(2-aminoethyl)amino]-2,4-dinitrophenyl}amino)-TEMPO |
| Stars | |
| Definition | A C-nitro compound that is the 4-({5-[(2-aminoethyl)amino]-2,4-dinitrophenyl}amino) derivative of TEMPO (PDB entry: 1BAF). |
| Last Modified | 13 September 2019 |
| Downloads |
| Formula | C17H27N6O5 |
| Net Charge | 0 |
| Average Mass | 395.440 |
| Monoisotopic Mass | 395.20429 |
| SMILES | CC1(C)CC(Nc2cc(NCCN)c([N+](=O)[O-])cc2[N+](=O)[O-])CC(C)(C)N1[O] |
| InChI | InChI=1S/C17H27N6O5/c1-16(2)9-11(10-17(3,4)23(16)28)20-13-7-12(19-6-5-18)14(21(24)25)8-15(13)22(26)27/h7-8,11,19-20H,5-6,9-10,18H2,1-4H3 |
| InChIKey | YKHCZDZMODGNFT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-({5-[(2-aminoethyl)amino]-2,4-dinitrophenyl}amino)-TEMPO (CHEBI:44491) has functional parent TEMPO (CHEBI:32849) |
| 4-({5-[(2-aminoethyl)amino]-2,4-dinitrophenyl}amino)-TEMPO (CHEBI:44491) has role epitope (CHEBI:53000) |
| 4-({5-[(2-aminoethyl)amino]-2,4-dinitrophenyl}amino)-TEMPO (CHEBI:44491) is a C-nitro compound (CHEBI:35716) |
| 4-({5-[(2-aminoethyl)amino]-2,4-dinitrophenyl}amino)-TEMPO (CHEBI:44491) is a aminopiperidine (CHEBI:48588) |
| 4-({5-[(2-aminoethyl)amino]-2,4-dinitrophenyl}amino)-TEMPO (CHEBI:44491) is a aminoxyls (CHEBI:39477) |
| IUPAC Name |
|---|
| [4-({5-[(2-aminoethyl)amino]-2,4-dinitrophenyl}amino)-2,2,6,6-tetramethylpiperidin-1-yl]oxidanyl |
| Synonyms | Source |
|---|---|
| N-(2-aminoethyl)-4,6-dinitro-N'-(2,2,6,6-tetramethyl-1-oxido-piperidin-4-yl)benzene-1,3-diamine | PDB |
| N-(2-AMINO-ETHYL)-4,6-DINITRO-N'-(2,2,6,6-TETRAMETHYL-1-OXY-PIPERIDIN-4-YL)-BENZENE-1,3-DIAMINE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| NPP | PDBeChem |
| Citations |
|---|