EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4N2O2 |
| Net Charge | 0 |
| Average Mass | 76.055 |
| Monoisotopic Mass | 76.02728 |
| SMILES | NC(=O)NO |
| InChI | InChI=1S/CH4N2O2/c2-1(4)3-5/h5H,(H3,2,3,4) |
| InChIKey | VSNHCAURESNICA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | antimitotic Any compound that inhibits cell division (mitosis). EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor An EC 1.17.* (oxidoreductase acting on CH or CH2) inhibitor that inhibits the action of ribonucleoside-diphosphate reductase (EC 1.17.4.1). immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxyurea (CHEBI:44423) has role antimetabolite (CHEBI:35221) |
| hydroxyurea (CHEBI:44423) has role antimitotic (CHEBI:64911) |
| hydroxyurea (CHEBI:44423) has role antineoplastic agent (CHEBI:35610) |
| hydroxyurea (CHEBI:44423) has role DNA synthesis inhibitor (CHEBI:59517) |
| hydroxyurea (CHEBI:44423) has role EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor (CHEBI:74213) |
| hydroxyurea (CHEBI:44423) has role genotoxin (CHEBI:50902) |
| hydroxyurea (CHEBI:44423) has role immunomodulator (CHEBI:50846) |
| hydroxyurea (CHEBI:44423) has role radical scavenger (CHEBI:48578) |
| hydroxyurea (CHEBI:44423) has role teratogenic agent (CHEBI:50905) |
| hydroxyurea (CHEBI:44423) is a one-carbon compound (CHEBI:64708) |
| hydroxyurea (CHEBI:44423) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| N-hydroxyurea |
| INNs | Source |
|---|---|
| hidroxicarbamida | ChemIDplus |
| hydroxycarbamide | WHO MedNet |
| hydroxycarbamide | ChemIDplus |
| hydroxycarbamidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| carbamohydroxamic acid | ChemIDplus |
| carbamohydroximic acid | ChemIDplus |
| carbamoyl oxime | ChemIDplus |
| carbamyl hydroxamate | ChemIDplus |
| N-carbamoylhydroxylamine | ChemIDplus |
| hydrea | ChemIDplus |
| UniProt Name | Source |
|---|---|
| hydroxyurea | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1399 | DrugCentral |
| C07044 | KEGG COMPOUND |
| D00341 | KEGG DRUG |
| DB01005 | DrugBank |
| HMDB0015140 | HMDB |
| Hydroxyurea | Wikipedia |
| HYDROXY-UREA | MetaCyc |
| NHY | PDBeChem |
| US2705727 | Patent |
| Registry Numbers | Sources |
|---|---|
| Gmelin:130423 | Gmelin |
| Beilstein:1741548 | Beilstein |
| Reaxys:1741548 | Reaxys |
| CAS:127-07-1 | ChemIDplus |
| CAS:127-07-1 | KEGG COMPOUND |
| Citations |
|---|