EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4N2O2 |
| Net Charge | 0 |
| Average Mass | 76.055 |
| Monoisotopic Mass | 76.02728 |
| SMILES | NC(=O)NO |
| InChI | InChI=1S/CH4N2O2/c2-1(4)3-5/h5H,(H3,2,3,4) |
| InChIKey | VSNHCAURESNICA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor An EC 1.17.* (oxidoreductase acting on CH or CH2) inhibitor that inhibits the action of ribonucleoside-diphosphate reductase (EC 1.17.4.1). antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. antimitotic Any compound that inhibits cell division (mitosis). genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. |
| Applications: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxyurea (CHEBI:44423) has role antimetabolite (CHEBI:35221) |
| hydroxyurea (CHEBI:44423) has role antimitotic (CHEBI:64911) |
| hydroxyurea (CHEBI:44423) has role antineoplastic agent (CHEBI:35610) |
| hydroxyurea (CHEBI:44423) has role DNA synthesis inhibitor (CHEBI:59517) |
| hydroxyurea (CHEBI:44423) has role EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor (CHEBI:74213) |
| hydroxyurea (CHEBI:44423) has role genotoxin (CHEBI:50902) |
| hydroxyurea (CHEBI:44423) has role immunomodulator (CHEBI:50846) |
| hydroxyurea (CHEBI:44423) has role radical scavenger (CHEBI:48578) |
| hydroxyurea (CHEBI:44423) has role teratogenic agent (CHEBI:50905) |
| hydroxyurea (CHEBI:44423) is a one-carbon compound (CHEBI:64708) |
| hydroxyurea (CHEBI:44423) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| N-hydroxyurea |
| INNs | Source |
|---|---|
| hidroxicarbamida | ChemIDplus |
| hydroxycarbamide | WHO MedNet |
| hydroxycarbamide | ChemIDplus |
| hydroxycarbamidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| carbamohydroxamic acid | ChemIDplus |
| carbamohydroximic acid | ChemIDplus |
| carbamoyl oxime | ChemIDplus |
| carbamyl hydroxamate | ChemIDplus |
| N-carbamoylhydroxylamine | ChemIDplus |
| hydrea | ChemIDplus |
| UniProt Name | Source |
|---|---|
| hydroxyurea | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1399 | DrugCentral |
| C07044 | KEGG COMPOUND |
| D00341 | KEGG DRUG |
| DB01005 | DrugBank |
| HMDB0015140 | HMDB |
| Hydroxyurea | Wikipedia |
| HYDROXY-UREA | MetaCyc |
| NHY | PDBeChem |
| US2705727 | Patent |
| Registry Numbers | Sources |
|---|---|
| Gmelin:130423 | Gmelin |
| Beilstein:1741548 | Beilstein |
| Reaxys:1741548 | Reaxys |
| CAS:127-07-1 | ChemIDplus |
| CAS:127-07-1 | KEGG COMPOUND |
| Citations |
|---|