EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:44423 - hydroxyurea
| Formula | CH4N2O2 |
| Net Charge | 0 |
| Average Mass | 76.055 |
| Monoisotopic Mass | 76.02728 |
| SMILES | NC(=O)NO |
| InChI | InChI=1S/CH4N2O2/c2-1(4)3-5/h5H,(H3,2,3,4) |
| InChIKey | VSNHCAURESNICA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antimitotic Any compound that inhibits cell division (mitosis). immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor An EC 1.17.* (oxidoreductase acting on CH or CH2) inhibitor that inhibits the action of ribonucleoside-diphosphate reductase (EC 1.17.4.1). anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Applications: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxyurea (CHEBI:44423) has role anti-anaemic agent (CHEBI:75835) |
| hydroxyurea (CHEBI:44423) has role anti-HIV agent (CHEBI:64946) |
| hydroxyurea (CHEBI:44423) has role antifibrotic agent (CHEBI:233423) |
| hydroxyurea (CHEBI:44423) has role antihypertensive agent (CHEBI:35674) |
| hydroxyurea (CHEBI:44423) has role antimetabolite (CHEBI:35221) |
| hydroxyurea (CHEBI:44423) has role antimitotic (CHEBI:64911) |
| hydroxyurea (CHEBI:44423) has role antineoplastic agent (CHEBI:35610) |
| hydroxyurea (CHEBI:44423) has role DNA synthesis inhibitor (CHEBI:59517) |
| hydroxyurea (CHEBI:44423) has role EC 1.17.4.1 (ribonucleoside-diphosphate reductase) inhibitor (CHEBI:74213) |
| hydroxyurea (CHEBI:44423) has role genotoxin (CHEBI:50902) |
| hydroxyurea (CHEBI:44423) has role immunomodulator (CHEBI:50846) |
| hydroxyurea (CHEBI:44423) has role immunosuppressive agent (CHEBI:35705) |
| hydroxyurea (CHEBI:44423) has role radical scavenger (CHEBI:48578) |
| hydroxyurea (CHEBI:44423) has role teratogenic agent (CHEBI:50905) |
| hydroxyurea (CHEBI:44423) is a one-carbon compound (CHEBI:64708) |
| hydroxyurea (CHEBI:44423) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| N-hydroxyurea |
| INNs | Source |
|---|---|
| hidroxicarbamida | ChemIDplus |
| hydroxycarbamide | ChemIDplus |
| hydroxycarbamide | WHO MedNet |
| hydroxycarbamidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| carbamohydroxamic acid | ChemIDplus |
| carbamohydroximic acid | ChemIDplus |
| carbamoyl oxime | ChemIDplus |
| carbamyl hydroxamate | ChemIDplus |
| N-carbamoylhydroxylamine | ChemIDplus |
| hydrea | ChemIDplus |
| Brand Name | Source |
|---|---|
| Droxia | ChEMBL |
| UniProt Name | Source |
|---|---|
| hydroxyurea | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1399 | DrugCentral |
| C07044 | KEGG COMPOUND |
| D00341 | KEGG DRUG |
| DB01005 | DrugBank |
| HMDB0015140 | HMDB |
| Hydroxyurea | Wikipedia |
| HYDROXY-UREA | MetaCyc |
| NHY | PDBeChem |
| US2705727 | Patent |
| Registry Numbers | Sources |
|---|---|
| Gmelin:130423 | Gmelin |
| Reaxys:1741548 | Reaxys |
| Beilstein:1741548 | Beilstein |
| CAS:127-07-1 | KEGG COMPOUND |
| CAS:127-07-1 | ChemIDplus |
| Citations |
|---|