EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO4 |
| Net Charge | 0 |
| Average Mass | 175.184 |
| Monoisotopic Mass | 175.08446 |
| SMILES | N[C@@H](CCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H13NO4/c8-5(7(11)12)3-1-2-4-6(9)10/h5H,1-4,8H2,(H,9,10)(H,11,12)/t5-/m0/s1 |
| InChIKey | JUQLUIFNNFIIKC-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-2-aminopimelic acid (CHEBI:44387) is a 2-aminopimelic acid (CHEBI:64305) |
| L-2-aminopimelic acid (CHEBI:44387) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| (2S)-2-aminoheptanedioic acid |
| Synonyms | Source |
|---|---|
| 2-AMINOPIMELIC ACID | PDBeChem |
| (2S)-2-aminoheptanedioic acid | PDBeChem |
| Apm | ChEBI |
| (S)-2-aminoheptanedioic acid | ChEBI |
| L-Apm | ChEBI |
| L-α-aminopimelic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| NPI | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724721 | Reaxys |
| Citations |
|---|