EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:44303 - L-m-tyrosine
| Formula | C9H11NO3 |
| Net Charge | 0 |
| Average Mass | 181.191 |
| Monoisotopic Mass | 181.07389 |
| SMILES | N[C@@H](Cc1cccc(O)c1)C(=O)O |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-2-1-3-7(11)4-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | JZKXXXDKRQWDET-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia myrsinites (ncbitaxon:212941) | root (BTO:0001188) | PubMed (22192329) | |
| Festuca rubra subsp. commutata (ncbitaxon:859837) | root (BTO:0001188) | PubMed (22192329) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-m-tyrosine (CHEBI:44303) has role plant metabolite (CHEBI:76924) |
| L-m-tyrosine (CHEBI:44303) is a L-phenylalanine derivative (CHEBI:84144) |
| L-m-tyrosine (CHEBI:44303) is a hydroxyphenylalanine (CHEBI:24734) |
| L-m-tyrosine (CHEBI:44303) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-m-tyrosine (CHEBI:44303) is a phenols (CHEBI:33853) |
| L-m-tyrosine (CHEBI:44303) is tautomer of L-m-tyrosine zwitterion (CHEBI:78290) |
| Incoming Relation(s) |
| L-m-tyrosine zwitterion (CHEBI:78290) is tautomer of L-m-tyrosine (CHEBI:44303) |
| IUPAC Names |
|---|
| 3-hydroxy-L-phenylalanine |
| (2S)-2-amino-3-(3-hydroxyphenyl)propanoic acid |
| Synonyms | Source |
|---|---|
| meta-tyrosine | ChEBI |
| m-tyrosine | ChEBI |
| L-mTyr | ChEBI |
| L-m-Tyr | ChEBI |
| L-m-tyrosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| MTY | PDBeChem |
| HMDB0059720 | HMDB |
| CPD-14541 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2416854 | Reaxys |
| Citations |
|---|