EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O7 |
| Net Charge | 0 |
| Average Mass | 398.411 |
| Monoisotopic Mass | 398.13655 |
| SMILES | [H][C@]12COC(=O)[C@]1([H])[C@H](c1cc(OC)c(OC)c(OC)c1)c1cc3c(cc1C2)OCO3 |
| InChI | InChI=1S/C22H22O7/c1-24-17-6-12(7-18(25-2)21(17)26-3)19-14-8-16-15(28-10-29-16)5-11(14)4-13-9-27-22(23)20(13)19/h5-8,13,19-20H,4,9-10H2,1-3H3/t13-,19+,20-/m0/s1 |
| InChIKey | ZGLXUQQMLLIKAN-SVIJTADQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anthriscus sylvestris (ncbitaxon:48027) | - | PubMed (25608854) | |
| Dysosma versipellis (ncbitaxon:93611) | - | PubMed (25712646) | |
| Juniperus communis (ncbitaxon:58039) | - | PubMed (24913660) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deoxypodophyllotoxin (CHEBI:4429) has role antineoplastic agent (CHEBI:35610) |
| deoxypodophyllotoxin (CHEBI:4429) has role apoptosis inducer (CHEBI:68495) |
| deoxypodophyllotoxin (CHEBI:4429) has role plant metabolite (CHEBI:76924) |
| deoxypodophyllotoxin (CHEBI:4429) is a furonaphthodioxole (CHEBI:50307) |
| deoxypodophyllotoxin (CHEBI:4429) is a lignan (CHEBI:25036) |
| deoxypodophyllotoxin (CHEBI:4429) is a methoxybenzenes (CHEBI:51683) |
| deoxypodophyllotoxin (CHEBI:4429) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (5R,5aR,8aR)-5-(3,4,5-trimethoxyphenyl)-5,8,8a,9-tetrahydro-2H-furo[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6(5aH)-one |
| Synonyms | Source |
|---|---|
| 4-Deoxypodophyllotoxin | ChemIDplus |
| (-)-Anthricin | ChemIDplus |
| Anthricin | KNApSAcK |
| (-)-Desoxypodophyllotoxin | ChemIDplus |
| Desoxypodophyllotoxin | ChemIDplus |
| Hernandin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (−)-deoxypodophyllotoxin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:98060 | Reaxys |
| CAS:19186-35-7 | ChemIDplus |
| CAS:19186-35-7 | KEGG COMPOUND |
| CAS:19186-35-7 | NIST Chemistry WebBook |
| Citations |
|---|