EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N2O |
| Net Charge | 0 |
| Average Mass | 226.279 |
| Monoisotopic Mass | 226.11061 |
| SMILES | CC(C)(C(=O)c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C14H14N2O/c1-14(2,12-6-4-8-16-10-12)13(17)11-5-3-7-15-9-11/h3-10H,1-2H3 |
| InChIKey | FJLBFSROUSIWMA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. EC 1.14.15.4 (steroid 11beta-monooxygenase) inhibitor An EC 1.14.15.* (oxidoreductase acting on paired donors, with reduced iron-sulfur protein as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of steroid 11β-monooxygenase (EC 1.14.15.4). |
| Application: | diagnostic agent A substance administered to aid diagnosis of a disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metyrapone (CHEBI:44241) has role antimetabolite (CHEBI:35221) |
| metyrapone (CHEBI:44241) has role diagnostic agent (CHEBI:33295) |
| metyrapone (CHEBI:44241) has role EC 1.14.15.4 (steroid 11β-monooxygenase) inhibitor (CHEBI:76798) |
| metyrapone (CHEBI:44241) is a aromatic ketone (CHEBI:76224) |
| IUPAC Name |
|---|
| 2-methyl-1,2-dipyridin-3-ylpropan-1-one |
| INNs | Source |
|---|---|
| metirapona | ChemIDplus |
| metyrapone | ChemIDplus |
| métyrapone | WHO MedNet |
| metyraponum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Metyrapone | KEGG COMPOUND |
| METYRAPONE | PDBeChem |
| Brand Names | Source |
|---|---|
| Metopiron | DrugBank |
| Metopirone | DrugBank |