EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O4 |
| Net Charge | 0 |
| Average Mass | 210.229 |
| Monoisotopic Mass | 210.08921 |
| SMILES | COc1ccc(CCC(=O)O)cc1OC |
| InChI | InChI=1S/C11H14O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3,5,7H,4,6H2,1-2H3,(H,12,13) |
| InChIKey | LHHKQWQTBCTDQM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3,4-dimethoxyphenyl)propanoic acid (CHEBI:44235) has functional parent propionic acid (CHEBI:30768) |
| 3-(3,4-dimethoxyphenyl)propanoic acid (CHEBI:44235) is a dimethoxybenzene (CHEBI:51681) |
| 3-(3,4-dimethoxyphenyl)propanoic acid (CHEBI:44235) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(3,4-dimethoxyphenyl)propanoic acid |
| Synonyms | Source |
|---|---|
| 3-(3,4-dimethoxyphenyl)propionic acid | ChEBI |
| 3,4-dimethoxy-α-β-dihydrocinnamic acid | ChEBI |