EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N7O14P2 |
| Net Charge | 0 |
| Average Mass | 663.430 |
| Monoisotopic Mass | 663.10912 |
| SMILES | NC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)([O-])OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C21H27N7O14P2/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(32)14(30)11(41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15(31)20(40-10)27-3-1-2-9(4-27)18(23)33/h1-4,7-8,10-11,13-16,20-21,29-32H,5-6H2,(H5-,22,23,24,25,33,34,35,36,37)/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1 |
| InChIKey | BAWFJGJZGIEFAR-NNYOXOHSSA-N |
| Roles Classification |
|---|
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NAD zwitterion (CHEBI:44215) has functional parent deamido-NAD zwitterion (CHEBI:14105) |
| NAD zwitterion (CHEBI:44215) has role geroprotector (CHEBI:176497) |
| NAD zwitterion (CHEBI:44215) is a NAD (CHEBI:13389) |
| NAD zwitterion (CHEBI:44215) is conjugate base of NAD+ (CHEBI:15846) |
| Incoming Relation(s) |
| NAD+ (CHEBI:15846) is conjugate acid of NAD zwitterion (CHEBI:44215) |
| IUPAC Name |
|---|
| adenosine 5'-{3-[1-(3-carbamoylpyridinio)-1,4-anhydro-D-ribitol-5-yl] hydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| codehydrogenase I | ChemIDplus |
| coenzyme I | ChemIDplus |
| cozymase I | ChemIDplus |
| diphosphopyridine nucleotide | ChemIDplus |
| DPN | ChemIDplus |
| nadide | ChemIDplus |
| Citations |
|---|