EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N6O15P2 |
| Net Charge | 0 |
| Average Mass | 664.414 |
| Monoisotopic Mass | 664.09314 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)([O-])OC[C@H]2O[C@@H]([n+]3cccc(C(=O)O)c3)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H26N6O15P2/c22-17-12-18(24-7-23-17)27(8-25-12)20-16(31)14(29)11(41-20)6-39-44(36,37)42-43(34,35)38-5-10-13(28)15(30)19(40-10)26-3-1-2-9(4-26)21(32)33/h1-4,7-8,10-11,13-16,19-20,28-31H,5-6H2,(H4-,22,23,24,32,33,34,35,36,37)/t10-,11-,13-,14-,15-,16-,19-,20-/m1/s1 |
| InChIKey | SENPVEZBRZQVST-HISDBWNOSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deamido-NAD zwitterion (CHEBI:14105) is a nicotinic acid dinucleotide (CHEBI:37584) |
| deamido-NAD zwitterion (CHEBI:14105) is conjugate acid of deamido-NAD(2−) (CHEBI:58437) |
| deamido-NAD zwitterion (CHEBI:14105) is conjugate base of deamido-NAD+ (CHEBI:18304) |
| Incoming Relation(s) |
| NAD zwitterion (CHEBI:44215) has functional parent deamido-NAD zwitterion (CHEBI:14105) |
| deamido-NAD+ (CHEBI:18304) is conjugate acid of deamido-NAD zwitterion (CHEBI:14105) |
| deamido-NAD(2−) (CHEBI:58437) is conjugate base of deamido-NAD zwitterion (CHEBI:14105) |
| IUPAC Name |
|---|
| adenosine 5'-{3-[1-(3-carboxypyridinio)-1,4-anhydro-D-ribitol-5-yl] hydrogen diphosphate} |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3865990 | Beilstein |