EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C56H80O2 |
| Net Charge | 0 |
| Average Mass | 785.254 |
| Monoisotopic Mass | 784.61583 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC1=C(C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C56H80O2/c1-42(2)22-14-23-43(3)24-15-25-44(4)26-16-27-45(5)28-17-29-46(6)30-18-31-47(7)32-19-33-48(8)34-20-35-49(9)36-21-37-50(10)40-41-52-51(11)55(57)53-38-12-13-39-54(53)56(52)58/h12-13,22,24,26,28,30,32,34,36,38-40H,14-21,23,25,27,29,31,33,35,37,41H2,1-11H3/b43-24+,44-26+,45-28+,46-30+,47-32+,48-34+,49-36+,50-40+ |
| InChIKey | WCRXHNIUHQUASO-UVZVDVBNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (7601837) | Isolated from purified nitrate reductase of Escherichia coli PK27 Strain: PK27 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| menaquinone-9 (CHEBI:44147) has role Escherichia coli metabolite (CHEBI:76971) |
| menaquinone-9 (CHEBI:44147) is a menaquinone (CHEBI:16374) |
| Incoming Relation(s) |
| β-dihydromenaquinone-9 (CHEBI:134607) has functional parent menaquinone-9 (CHEBI:44147) |
| ω-hydroxy-β-dihydromenaquinone-9 (CHEBI:140189) has functional parent menaquinone-9 (CHEBI:44147) |
| Synonyms | Source |
|---|---|
| Menaquinone 9 | ChemIDplus |
| menaquinone with nine isoprene units | ChEBI |
| MK-9 | LIPID MAPS |
| MK9 | MetaCyc |
| UniProt Name | Source |
|---|---|
| menaquinone-9 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C21526 | KEGG COMPOUND |
| CPD-9720 | MetaCyc |
| LMPR02010041 | LIPID MAPS |
| MQ9 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2069069 | Reaxys |
| CAS:523-39-7 | ChemIDplus |
| Citations |
|---|