EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O3 |
| Net Charge | 0 |
| Average Mass | 302.374 |
| Monoisotopic Mass | 302.16304 |
| SMILES | CCOCn1c(Cc2ccccc2)c(C(C)C)c(=O)nc1=O |
| InChI | InChI=1S/C17H22N2O3/c1-4-22-11-19-14(10-13-8-6-5-7-9-13)15(12(2)3)16(20)18-17(19)21/h5-9,12H,4,10-11H2,1-3H3,(H,18,20,21) |
| InChIKey | MLILORUFDVLTSP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emivirine (CHEBI:44143) has functional parent uracil (CHEBI:17568) |
| emivirine (CHEBI:44143) has role antiviral drug (CHEBI:36044) |
| emivirine (CHEBI:44143) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| emivirine (CHEBI:44143) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 6-benzyl-1-(ethoxymethyl)-5-(propan-2-yl)pyrimidine-2,4(1H,3H)-dione |
| INN | Source |
|---|---|
| emivirine | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(ethoxymethyl)-5-(1-methylethyl)-6-(phenylmethyl)pyrimidine-2,4(1H,3H)-dione | ChEBI |
| 6-benzyl-1-(ethoxymethyl)-5-(1-methylethyl)uracil | ChEBI |
| 6-BENZYL-1-ETHOXYMETHYL-5-ISOPROPYL URACIL | PDBeChem |
| MKC-442 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Coactinon | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7340168 | Reaxys |
| CAS:149950-60-7 | ChemIDplus |
| Citations |
|---|