EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4414 - deoxylapachol
| Formula | C15H14O2 |
| Net Charge | 0 |
| Average Mass | 226.275 |
| Monoisotopic Mass | 226.09938 |
| SMILES | CC(C)=CCC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H14O2/c1-10(2)7-8-11-9-14(16)12-5-3-4-6-13(12)15(11)17/h3-7,9H,8H2,1-2H3 |
| InChIKey | OSDFYZPKJKRCRR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tectona grandis (ncbitaxon:41396) | - | PubMed (6521757) | |
| Landsburgia quercifolia (ncbitaxon:590122) | - | PubMed (1791483) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deoxylapachol (CHEBI:4414) has role algal metabolite (CHEBI:84735) |
| deoxylapachol (CHEBI:4414) has role antifungal agent (CHEBI:35718) |
| deoxylapachol (CHEBI:4414) has role antineoplastic agent (CHEBI:35610) |
| deoxylapachol (CHEBI:4414) has role marine metabolite (CHEBI:76507) |
| deoxylapachol (CHEBI:4414) has role plant metabolite (CHEBI:76924) |
| deoxylapachol (CHEBI:4414) is a 1,4-naphthoquinones (CHEBI:132142) |
| deoxylapachol (CHEBI:4414) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 2-(3-methylbut-2-en-1-yl)naphthalene-1,4-dione |
| Synonyms | Source |
|---|---|
| desoxylapachol | ChEBI |
| 2-(3-methyl-2-butenyl)naphthalene-1,4-dione | ChEBI |
| 2-(3-methyl-2-buten-1-yl)-1,4-naphthalenedione | ChEBI |
| 2-(3-methyl-2-butenyl)-1,4-naphthoquinone | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-prenyl-1,4-naphthoquinone | UniProt |
| Citations |
|---|