EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4414 - deoxylapachol
| Formula | C15H14O2 |
| Net Charge | 0 |
| Average Mass | 226.275 |
| Monoisotopic Mass | 226.09938 |
| SMILES | CC(C)=CCC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H14O2/c1-10(2)7-8-11-9-14(16)12-5-3-4-6-13(12)15(11)17/h3-7,9H,8H2,1-2H3 |
| InChIKey | OSDFYZPKJKRCRR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Landsburgia quercifolia (ncbitaxon:590122) | - | PubMed (1791483) | |
| Tectona grandis (ncbitaxon:41396) | - | PubMed (6521757) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deoxylapachol (CHEBI:4414) has role algal metabolite (CHEBI:84735) |
| deoxylapachol (CHEBI:4414) has role antifungal agent (CHEBI:35718) |
| deoxylapachol (CHEBI:4414) has role antineoplastic agent (CHEBI:35610) |
| deoxylapachol (CHEBI:4414) has role marine metabolite (CHEBI:76507) |
| deoxylapachol (CHEBI:4414) has role plant metabolite (CHEBI:76924) |
| deoxylapachol (CHEBI:4414) is a 1,4-naphthoquinones (CHEBI:132142) |
| deoxylapachol (CHEBI:4414) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 2-(3-methylbut-2-en-1-yl)naphthalene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2-(3-methyl-2-buten-1-yl)-1,4-naphthalenedione | ChEBI |
| 2-(3-methyl-2-butenyl)-1,4-naphthoquinone | ChEBI |
| 2-(3-methyl-2-butenyl)naphthalene-1,4-dione | ChEBI |
| desoxylapachol | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-prenyl-1,4-naphthoquinone | UniProt |
| Citations |
|---|