EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6O2S |
| Net Charge | 0 |
| Average Mass | 106.146 |
| Monoisotopic Mass | 106.00885 |
| SMILES | O=C(O)CCS |
| InChI | InChI=1S/C3H6O2S/c4-3(5)1-2-6/h6H,1-2H2,(H,4,5) |
| InChIKey | DKIDEFUBRARXTE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Thalassiosira pseudonana CCMP1335 (ncbitaxon:296543) | - | MetaboLights (MTBLS154) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-mercaptopropanoic acid (CHEBI:44111) has role algal metabolite (CHEBI:84735) |
| 3-mercaptopropanoic acid (CHEBI:44111) is a mercaptopropanoic acid (CHEBI:47871) |
| 3-mercaptopropanoic acid (CHEBI:44111) is conjugate acid of 3-mercaptopropionate (CHEBI:86386) |
| Incoming Relation(s) |
| 3-mercaptopropionate (CHEBI:86386) is conjugate base of 3-mercaptopropanoic acid (CHEBI:44111) |
| IUPAC Name |
|---|
| 3-sulfanylpropanoic acid |
| Synonyms | Source |
|---|---|
| 2-mercaptoethanecarboxylic acid | ChemIDplus |
| 3-mercaptopropanoic acid | NIST Chemistry WebBook |
| 3-mercaptopropionic acid | ChemIDplus |
| 3MPA | ChemIDplus |
| 3-thiohydracrylic acid | NIST Chemistry WebBook |
| 3-thiolpropanoic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| CPD-7673 | MetaCyc |
| HMDB0041604 | HMDB |
| MPT | PDBeChem |
| Citations |
|---|