EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28O6 |
| Net Charge | 0 |
| Average Mass | 400.471 |
| Monoisotopic Mass | 400.18859 |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc3c(c1OC)OCO3)C[C@H](C)[C@H](C)C2 |
| InChI | InChI=1S/C23H28O6/c1-12-7-14-9-16(24-3)20(25-4)22(26-5)18(14)19-15(8-13(12)2)10-17-21(23(19)27-6)29-11-28-17/h9-10,12-13H,7-8,11H2,1-6H3/t12-,13+/m1/s1 |
| InChIKey | RTZKSTLPRTWFEV-OLZOCXBDSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Deoxygomisin A (CHEBI:4410) is a tannin (CHEBI:26848) |
| Synonyms | Source |
|---|---|
| Deoxygomisin A | KEGG COMPOUND |
| (+)-gamma-Schizandrin | KEGG COMPOUND |