EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2O3 |
| Net Charge | 0 |
| Average Mass | 146.146 |
| Monoisotopic Mass | 146.06914 |
| SMILES | CNC(=O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H10N2O3/c1-7-4(8)2-3(6)5(9)10/h3H,2,6H2,1H3,(H,7,8)(H,9,10)/t3-/m0/s1 |
| InChIKey | CFRMVEKWKKDNAH-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N4-methyl-L-asparagine (CHEBI:44079) is a N-methyl-L-asparagine (CHEBI:21753) |
| Incoming Relation(s) |
| N4-methyl-L-asparagine residue (CHEBI:61960) is substituent group from N4-methyl-L-asparagine (CHEBI:44079) |
| IUPAC Name |
|---|
| N-methyl-L-asparagine |
| Synonyms | Source |
|---|---|
| Nγ-methylasparagine | ChEBI |
| N4-methylasparagine | ChEBI |
| Nγ-methyl-L-asparagine | ChEBI |
| Asn-NHMe | ChEBI |
| Asn-NH-CH3 | ChEBI |
| Asn(Me) | ChEBI |
| Citations |
|---|