EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13N3O3 |
| Net Charge | 0 |
| Average Mass | 199.210 |
| Monoisotopic Mass | 199.09569 |
| SMILES | Cc1nc([C@H](C)N)n(CC(=O)O)c1O |
| InChI | InChI=1S/C8H13N3O3/c1-4(9)7-10-5(2)8(14)11(7)3-6(12)13/h4,14H,3,9H2,1-2H3,(H,12,13)/t4-/m0/s1 |
| InChIKey | GYCBVEGTLQBIBF-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(1S)-1-aminoethyl]-1-carboxymethyl-5-hydroxy-4-methylimidazole (CHEBI:44061) is a hydroxyimidazole (CHEBI:88291) |
| 2-[(1S)-1-aminoethyl]-1-carboxymethyl-5-hydroxy-4-methylimidazole (CHEBI:44061) is a imidazoles (CHEBI:24780) |
| 2-[(1S)-1-aminoethyl]-1-carboxymethyl-5-hydroxy-4-methylimidazole (CHEBI:44061) is a monocarboxylic acid (CHEBI:25384) |
| 2-[(1S)-1-aminoethyl]-1-carboxymethyl-5-hydroxy-4-methylimidazole (CHEBI:44061) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| {2-[(1S)-1-aminoethyl]-5-hydroxy-4-methyl-1H-imidazol-1-yl}acetic acid |
| Manual Xrefs | Databases |
|---|---|
| MDO | PDBeChem |