EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O5 |
| Net Charge | 0 |
| Average Mass | 178.184 |
| Monoisotopic Mass | 178.08412 |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](C)O[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14O5/c1-3-4(8)6(11-2)5(9)7(10)12-3/h3-10H,1-2H3/t3-,4-,5+,6+,7+/m0/s1 |
| InChIKey | OEKPKBBXXDGXNB-PAMBMQIZSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-methyl-α-L-rhamnose (CHEBI:44042) has functional parent α-L-rhamnopyranose (CHEBI:27907) |
| 3-O-methyl-α-L-rhamnose (CHEBI:44042) has role epitope (CHEBI:53000) |
| 3-O-methyl-α-L-rhamnose (CHEBI:44042) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 3-O-methyl-α-L-rhamnopyranose |
| Synonyms | Source |
|---|---|
| 3MeRha | ChEBI |
| 3Me-L-Rha | ChEBI |
| 6-deoxy-3-O-methyl-α-L-mannopyranose | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| MRP | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2205581 | Reaxys |
| Citations |
|---|