EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18O |
| Net Charge | 0 |
| Average Mass | 130.231 |
| Monoisotopic Mass | 130.13577 |
| SMILES | CC(C)CCCCCO |
| InChI | InChI=1S/C8H18O/c1-8(2)6-4-3-5-7-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | BWDBEAQIHAEVLV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Millardia meltada (ncbitaxon:121583) | - | PubMed (29856754) | Identified in the crude extract of preputial gland |
| Roles Classification |
|---|
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methylheptan-1-ol (CHEBI:44009) has role mammalian metabolite (CHEBI:75768) |
| 6-methylheptan-1-ol (CHEBI:44009) is a primary alcohol (CHEBI:15734) |
| 6-methylheptan-1-ol (CHEBI:44009) is a volatile organic compound (CHEBI:134179) |
| Incoming Relation(s) |
| isooctyl laurate (CHEBI:143015) has functional parent 6-methylheptan-1-ol (CHEBI:44009) |
| IUPAC Name |
|---|
| 6-methylheptan-1-ol |
| Synonyms | Source |
|---|---|
| 6-methyl-1-heptanol | NIST Chemistry WebBook |
| 6-methylheptanol | NIST Chemistry WebBook |
| Citations |
|---|