EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2S |
| Net Charge | 0 |
| Average Mass | 163.242 |
| Monoisotopic Mass | 163.06670 |
| SMILES | CN[C@@H](CCSC)C(=O)O |
| InChI | InChI=1S/C6H13NO2S/c1-7-5(6(8)9)3-4-10-2/h5,7H,3-4H2,1-2H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | YAXAFCHJCYILRU-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-L-methionine (CHEBI:44003) is a N-methyl-L-α-amino acid (CHEBI:21752) |
| N-methyl-L-methionine (CHEBI:44003) is a methyl-L-methionine (CHEBI:25268) |
| N-methyl-L-methionine (CHEBI:44003) is tautomer of N-methyl-L-methionine zwitterion (CHEBI:61885) |
| Incoming Relation(s) |
| N-methyl-L-methionine zwitterion (CHEBI:61885) is tautomer of N-methyl-L-methionine (CHEBI:44003) |
| IUPAC Name |
|---|
| N-methyl-L-methionine |
| Synonyms | Source |
|---|---|
| N-Me-Met | ChEBI |
| N-Me-Met-OH | ChEBI |
| N-Me-L-Met | ChEBI |
| N-Me-L-Met-OH | ChEBI |
| N-methylmethionine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| MME | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6856058 | Reaxys |
| CAS:42537-72-4 | ChemIDplus |
| Citations |
|---|