EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:43996 - mitoguazone
| Formula | C5H12N8 |
| Net Charge | 0 |
| Average Mass | 184.207 |
| Monoisotopic Mass | 184.11849 |
| SMILES | CC(/C=N/NC(=N)N)=N\NC(=N)N |
| InChI | InChI=1S/C5H12N8/c1-3(11-13-5(8)9)2-10-12-4(6)7/h2H,1H3,(H4,6,7,12)(H4,8,9,13)/b10-2+,11-3+ |
| InChIKey | MXWHMTNPTTVWDM-NXOFHUPFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 4.1.1.50 (adenosylmethionine decarboxylase) inhibitor An EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of adenosylmethionine decarboxylase (EC 4.1.1.50). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mitoguazone (CHEBI:43996) has functional parent aminoguanidine (CHEBI:40618) |
| mitoguazone (CHEBI:43996) has functional parent methylglyoxal (CHEBI:17158) |
| mitoguazone (CHEBI:43996) has role antineoplastic agent (CHEBI:35610) |
| mitoguazone (CHEBI:43996) has role apoptosis inducer (CHEBI:68495) |
| mitoguazone (CHEBI:43996) has role EC 4.1.1.50 (adenosylmethionine decarboxylase) inhibitor (CHEBI:78024) |
| mitoguazone (CHEBI:43996) is a guanidines (CHEBI:24436) |
| mitoguazone (CHEBI:43996) is a hydrazone (CHEBI:38532) |
| mitoguazone (CHEBI:43996) is conjugate base of mitoguazone(2+) (CHEBI:78025) |
| Incoming Relation(s) |
| mitoguazone(2+) (CHEBI:78025) is conjugate acid of mitoguazone (CHEBI:43996) |
| INNs | Source |
|---|---|
| mitoguazona | ChemIDplus |
| mitoguazonum | ChemIDplus |
| mitoguazone | ChemIDplus |
| mitoguazone | WHO MedNet |
| Synonyms | Source |
|---|---|
| Methylglyoxal bis(guanylhydrazone) | ChemIDplus |
| Methylglyoxal bis(amidinohydrazone) | ChemIDplus |
| Methyl-Gag | ChemIDplus |
| Me-GAG | ChemIDplus |
| Pyruvaldehyde bis(amidinohydrazone) | ChemIDplus |
| MGBG | MetaCyc |
| Citations |
|---|