EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO2 |
| Net Charge | 0 |
| Average Mass | 145.202 |
| Monoisotopic Mass | 145.11028 |
| SMILES | CNC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C7H15NO2/c1-5(2)4-6(8-3)7(9)10/h5-6,8H,4H2,1-3H3,(H,9,10) |
| InChIKey | XJODGRWDFZVTKW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS298) | ||
| - | PubMed (26839171) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylleucine (CHEBI:43983) is a amino acid (CHEBI:33709) |
| N-methylleucine (CHEBI:43983) is a leucine derivative (CHEBI:47003) |
| N-methylleucine (CHEBI:43983) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N-methylleucine |
| Synonym | Source |
|---|---|
| 4-methyl-2-(methylamino)pentanoic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 493595 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722010 | Reaxys |