EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO2 |
| Net Charge | 0 |
| Average Mass | 179.219 |
| Monoisotopic Mass | 179.09463 |
| SMILES | CN[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C10H13NO2/c1-11-9(10(12)13)7-8-5-3-2-4-6-8/h2-6,9,11H,7H2,1H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | SCIFESDRCALIIM-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-L-phenylalanine (CHEBI:43980) is a N-methyl-L-α-amino acid (CHEBI:21752) |
| N-methyl-L-phenylalanine (CHEBI:43980) is a L-phenylalanine derivative (CHEBI:84144) |
| N-methyl-L-phenylalanine (CHEBI:43980) is tautomer of N-methyl-L-phenylalanine zwitterion (CHEBI:61883) |
| Incoming Relation(s) |
| N-methyl-L-phenylalanine residue (CHEBI:61884) is substituent group from N-methyl-L-phenylalanine (CHEBI:43980) |
| N-methyl-L-phenylalanine zwitterion (CHEBI:61883) is tautomer of N-methyl-L-phenylalanine (CHEBI:43980) |
| IUPAC Name |
|---|
| N-methyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| N-Me-Phe | ChEBI |
| N-Me-Phe-OH | ChEBI |
| N-Me-L-Phe | ChEBI |
| N-Me-L-Phe-OH | ChEBI |
| (S)-2-(N-methylamino)-3-phenylpropionic acid | ChEBI |
| N-METHYLPHENYLALANINE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| MEA | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2096928 | Reaxys |
| Citations |
|---|