EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19N5O11P2 |
| Net Charge | 0 |
| Average Mass | 459.245 |
| Monoisotopic Mass | 459.05563 |
| SMILES | CN1CN([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c2nc(N)nc(=O)c21 |
| InChI | InChI=1S/C11H19N5O11P2/c1-15-3-16(8-5(15)9(19)14-11(12)13-8)10-7(18)6(17)4(26-10)2-25-29(23,24)27-28(20,21)22/h4,6-7,10,17-18H,2-3H2,1H3,(H,23,24)(H2,20,21,22)(H3,12,13,14,19)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | QQODJOAVWUWVHJ-KQYNXXCUSA-N |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methyl-7,8-dihydroguanosine-5'-diphosphate (CHEBI:43977) is a purine ribonucleoside 5'-diphosphate (CHEBI:37038) |
| 7-methyl-7,8-dihydroguanosine-5'-diphosphate (CHEBI:43977) is conjugate acid of 7-methyl-7,8-dihydroguanosine-5'-diphosphate(3−) (CHEBI:63814) |
| Incoming Relation(s) |
| 7-methyl-7,8-dihydroguanosine-5'-diphosphate(3−) (CHEBI:63814) is conjugate base of 7-methyl-7,8-dihydroguanosine-5'-diphosphate (CHEBI:43977) |
| IUPAC Name |
|---|
| 7-methyl-7,8-dihydroguanosine 5'-(trihydrogen diphosphate) |
| Synonym | Source |
|---|---|
| 7N-METHYL-8-HYDROGUANOSINE-5'-DIPHOSPHATE | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1198218 | Reaxys |
| CAS:104809-16-7 | ChemIDplus |