EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25NO5 |
| Net Charge | 0 |
| Average Mass | 371.433 |
| Monoisotopic Mass | 371.17327 |
| SMILES | CN[C@H]1CCc2cc(OC)c(OC)c(OC)c2-c2ccc(OC)c(=O)cc21 |
| InChI | InChI=1S/C21H25NO5/c1-22-15-8-6-12-10-18(25-3)20(26-4)21(27-5)19(12)13-7-9-17(24-2)16(23)11-14(13)15/h7,9-11,15,22H,6,8H2,1-5H3/t15-/m0/s1 |
| InChIKey | NNJPGOLRFBJNIW-HNNXBMFYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-demecolcine (CHEBI:4393) has role antineoplastic agent (CHEBI:35610) |
| (−)-demecolcine (CHEBI:4393) has role microtubule-destabilising agent (CHEBI:61951) |
| (−)-demecolcine (CHEBI:4393) is a alkaloid (CHEBI:22315) |
| (−)-demecolcine (CHEBI:4393) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (7S)-1,2,3,10-tetramethoxy-7-(methylamino)-6,7-dihydrobenzo[a]heptalen-9(5H)-one |
| INNs | Source |
|---|---|
| demecolcina | ChemIDplus |
| demecolcinum | ChemIDplus |
| demecolcine | ChemIDplus |
| Synonyms | Source |
|---|---|
| Colcemid | KEGG COMPOUND |
| Reichstein's F | ChemIDplus |
| N-methyl-N-deacetylcolchicine | ChemIDplus |
| (−)-colchamine | ChemIDplus |
| N-deacetyl-N-methylcolchicine | ChemIDplus |
| N-methyl-N-desacetylcolchicine | ChemIDplus |
| Citations |
|---|