EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21ClN2O8 |
| Net Charge | 0 |
| Average Mass | 464.858 |
| Monoisotopic Mass | 464.09864 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)ccc(Cl)c1[C@H]2O |
| InChI | InChI=1S/C21H21ClN2O8/c1-24(2)14-7-5-6-10(16(27)12-9(25)4-3-8(22)11(12)15(6)26)18(29)21(7,32)19(30)13(17(14)28)20(23)31/h3-4,6-7,14-15,25-26,28-29,32H,5H2,1-2H3,(H2,23,31)/t6-,7-,14-,15-,21-/m0/s1 |
| InChIKey | FMTDIUIBLCQGJB-SEYHBJAFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. aquaretic A class of diuretics which promote aquaresis (the excretion of water without electrolyte loss). antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| demeclocycline (CHEBI:4392) has role antibacterial drug (CHEBI:36047) |
| demeclocycline (CHEBI:4392) has role aquaretic (CHEBI:194423) |
| demeclocycline (CHEBI:4392) has role geroprotector (CHEBI:176497) |
| demeclocycline (CHEBI:4392) is a tetracyclines (CHEBI:26895) |
| Incoming Relation(s) |
| demeclocycline hydrochloride (CHEBI:59725) has part demeclocycline (CHEBI:4392) |
| IUPAC Name |
|---|
| (4S,4aS,5aS,6S,12aS)-7-chloro-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| demeclociclina | ChemIDplus |
| demeclocycline | ChemIDplus |
| demeclocyclinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| [4S-(4α,4aα,5aα,6β,12aα)]-7-chloro-4-(dimethylamino)1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-1,11-dioxo-2-naphthacenecarboxamide | ChEBI |
| 6-demethyl-7-chlorotetracycline | ChemIDplus |
| 7-chloro-6-demethyltetracycline | ChEBI |
| Demeclocycline | ChEMBL |
| demethylchlortetracycline | KEGG DRUG |
| DMCT | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2230579 | Beilstein |
| CAS:127-33-3 | KEGG COMPOUND |
| CAS:127-33-3 | KEGG DRUG |
| CAS:127-33-3 | ChemIDplus |
| Citations |
|---|