EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21ClN2O8 |
| Net Charge | 0 |
| Average Mass | 464.858 |
| Monoisotopic Mass | 464.09864 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)ccc(Cl)c1[C@H]2O |
| InChI | InChI=1S/C21H21ClN2O8/c1-24(2)14-7-5-6-10(16(27)12-9(25)4-3-8(22)11(12)15(6)26)18(29)21(7,32)19(30)13(17(14)28)20(23)31/h3-4,6-7,14-15,25-26,28-29,32H,5H2,1-2H3,(H2,23,31)/t6-,7-,14-,15-,21-/m0/s1 |
| InChIKey | FMTDIUIBLCQGJB-SEYHBJAFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | aquaretic A class of diuretics which promote aquaresis (the excretion of water without electrolyte loss). antibacterial drug A drug used to treat or prevent bacterial infections. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| demeclocycline (CHEBI:4392) has role antibacterial agent (CHEBI:33282) |
| demeclocycline (CHEBI:4392) has role antibacterial drug (CHEBI:36047) |
| demeclocycline (CHEBI:4392) has role aquaretic (CHEBI:194423) |
| demeclocycline (CHEBI:4392) has role geroprotector (CHEBI:176497) |
| demeclocycline (CHEBI:4392) is a tetracyclines (CHEBI:26895) |
| Incoming Relation(s) |
| demeclocycline hydrochloride (CHEBI:59725) has part demeclocycline (CHEBI:4392) |
| IUPAC Name |
|---|
| (4S,4aS,5aS,6S,12aS)-7-chloro-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| demeclociclina | ChemIDplus |
| demeclocycline | ChemIDplus |
| demeclocyclinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| [4S-(4α,4aα,5aα,6β,12aα)]-7-chloro-4-(dimethylamino)1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-1,11-dioxo-2-naphthacenecarboxamide | ChEBI |
| 6-demethyl-7-chlorotetracycline | ChemIDplus |
| 7-chloro-6-demethyltetracycline | ChEBI |
| Demeclocycline | ChEMBL |
| demethylchlortetracycline | KEGG DRUG |
| DMCT | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2230579 | Beilstein |
| CAS:127-33-3 | KEGG COMPOUND |
| CAS:127-33-3 | ChemIDplus |
| CAS:127-33-3 | KEGG DRUG |
| Citations |
|---|