EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO4 |
| Net Charge | 0 |
| Average Mass | 209.201 |
| Monoisotopic Mass | 209.06881 |
| SMILES | C[C@@](N)(C(=O)O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C10H11NO4/c1-10(11,9(14)15)7-4-2-6(3-5-7)8(12)13/h2-5H,11H2,1H3,(H,12,13)(H,14,15)/t10-/m0/s1 |
| InChIKey | DNCAZYRLRMTVSF-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabotropic glutamate receptor antagonist An antagonist at the metabotropic glutamate receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-α-methyl-4-carboxyphenylglycine (CHEBI:43876) has role metabotropic glutamate receptor antagonist (CHEBI:63963) |
| (S)-α-methyl-4-carboxyphenylglycine (CHEBI:43876) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| 4-[(1S)-1-amino-1-carboxyethyl]benzoic acid |
| Synonyms | Source |
|---|---|
| (S)-a-methyl-4-carboxyphenylglycine | ChEBI |
| (S)-MCPG | ChEBI |
| (S)-(+)-α-methyl-4-carboxyphenylglycine | ChEBI |
| (+)-MCPG | ChEBI |
| (S)-(ALPHA)-METHYL-4-CARBOXYPHENYLGLYCINE | PDBeChem |
| (S)-(+)-α-amino-4-carboxy-2-methylbenzeneacetic | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| MCG | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7568949 | Reaxys |