EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | C[C@@H](C=O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H11NO3/c1-4(3-8)2-5(7)6(9)10/h3-5H,2,7H2,1H3,(H,9,10)/t4-,5+/m1/s1 |
| InChIKey | ALVALNHXAQAJAM-UHNVWZDZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R)-5-oxo-L-leucine (CHEBI:43739) is a L-leucine derivative (CHEBI:25018) |
| (4R)-5-oxo-L-leucine (CHEBI:43739) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| (4R)-5-oxo-L-leucine |
| Synonym | Source |
|---|---|
| (2S,4R)-2-amino-4-methyl-5-oxopentanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LED | PDBeChem |