EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H28O2 |
| Net Charge | 0 |
| Average Mass | 228.376 |
| Monoisotopic Mass | 228.20893 |
| SMILES | CC(C)CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C14H28O2/c1-13(2)11-9-7-5-3-4-6-8-10-12-14(15)16/h13H,3-12H2,1-2H3,(H,15,16) |
| InChIKey | YYVJAABUJYRQJO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isomyristic acid (CHEBI:43722) is a branched-chain saturated fatty acid (CHEBI:39417) |
| isomyristic acid (CHEBI:43722) is a long-chain fatty acid (CHEBI:15904) |
| isomyristic acid (CHEBI:43722) is conjugate acid of isomyristate (CHEBI:84193) |
| Incoming Relation(s) |
| isomyristoyl-CoA (CHEBI:85077) has functional parent isomyristic acid (CHEBI:43722) |
| isomyristate (CHEBI:84193) is conjugate base of isomyristic acid (CHEBI:43722) |
| IUPAC Name |
|---|
| 12-methyltridecanoic acid |
| Synonyms | Source |
|---|---|
| 12-Methyltridecancarbonsäure | ChEBI |
| 12-Methyltridecansäure | ChEBI |
| 12-methyltridecylic acid | LIPID MAPS |
| aseanostatin P1 | ChemIDplus |
| C14:0 iso | ChEBI |
| i14:0 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020007 | LIPID MAPS |
| LNG | PDBeChem |
| Citations |
|---|