EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O3 |
| Net Charge | 0 |
| Average Mass | 222.284 |
| Monoisotopic Mass | 222.12559 |
| SMILES | CC(=O)/C=C/[C@@]1(O)C(C)=CC(=O)CC1(C)C |
| InChI | InChI=1S/C13H18O3/c1-9-7-11(15)8-12(3,4)13(9,16)6-5-10(2)14/h5-7,16H,8H2,1-4H3/b6-5+/t13-/m1/s1 |
| InChIKey | JJRYPZMXNLLZFH-URWSZGRFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sanicula lamelligera (ncbitaxon:84533) | whole plant (BTO:0001461) | PubMed (21561060) | 80% aqueous ethanolic extract of dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6S)-dehydrovomifoliol (CHEBI:4372) has role plant metabolite (CHEBI:76924) |
| (6S)-dehydrovomifoliol (CHEBI:4372) is a dehydrovomifoliol (CHEBI:18429) |
| (6S)-dehydrovomifoliol (CHEBI:4372) is enantiomer of (6R)-dehydrovomifoliol (CHEBI:49177) |
| Incoming Relation(s) |
| (6R)-dehydrovomifoliol (CHEBI:49177) is enantiomer of (6S)-dehydrovomifoliol (CHEBI:4372) |
| IUPAC Name |
|---|
| (4S)-4-hydroxy-3,5,5-trimethyl-4-[(1E)-3-oxobut-1-en-1-yl]cyclohex-2-en-1-one |
| Synonyms | Source |
|---|---|
| (4S)-4-hydroxy-3,5,5-trimethyl-4-[(1E)-3-oxobut-1-enyl]cyclohex-2-en-1-one | IUBMB |
| (6R)-6-Hydroxy-3-oxo-alpha-ionone | KEGG COMPOUND |
| Dehydrovomifoliol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (6S)-6-hydroxy-3-oxo-α-ionone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02533 | KEGG COMPOUND |
| LMPR0103050009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2050827 | Beilstein |
| CAS:15764-81-5 | KEGG COMPOUND |