EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:43689 - isopentylamine
| Formula | C5H13N |
| Net Charge | 0 |
| Average Mass | 87.166 |
| Monoisotopic Mass | 87.10480 |
| SMILES | CC(C)CCN |
| InChI | InChI=1S/C5H13N/c1-5(2)3-4-6/h5H,3-4,6H2,1-2H3 |
| InChIKey | BMFVGAAISNGQNM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isopentylamine (CHEBI:43689) has role bacterial metabolite (CHEBI:76969) |
| isopentylamine (CHEBI:43689) has role plant metabolite (CHEBI:76924) |
| isopentylamine (CHEBI:43689) is a primary aliphatic amine (CHEBI:17062) |
| IUPAC Name |
|---|
| 3-methylbutan-1-amine |
| Synonyms | Source |
|---|---|
| Isovalerylamine | ChemIDplus |
| gamma-Isoamylamine | ChemIDplus |
| 3-Methylbutanamine | ChemIDplus |
| 1-Amino-3-methylbutane | ChemIDplus |
| Isopentylamine | ChemIDplus |
| Isobutylcarbylamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LEN | PDBeChem |
| HMDB0031659 | HMDB |
| C02640 | KEGG COMPOUND |
| Citations |
|---|