EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:43636 - 5-iodouracil
| Formula | C4H3IN2O2 |
| Net Charge | 0 |
| Average Mass | 237.984 |
| Monoisotopic Mass | 237.92393 |
| SMILES | O=c1ncc(I)c(=O)n1 |
| InChI | InChI=1S/C4H3IN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
| InChIKey | KSNXJLQDQOIRIP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-iodouracil (CHEBI:43636) has functional parent uracil (CHEBI:17568) |
| 5-iodouracil (CHEBI:43636) has role antimetabolite (CHEBI:35221) |
| 5-iodouracil (CHEBI:43636) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 5-iodopyrimidine-2,4(1H,3H)-dione |
| Citations |
|---|