EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O2 |
| Net Charge | 0 |
| Average Mass | 252.313 |
| Monoisotopic Mass | 252.11503 |
| SMILES | C=C[C@@H](/C=C/c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H16O2/c1-2-14(15-7-11-17(19)12-8-15)6-3-13-4-9-16(18)10-5-13/h2-12,14,18-19H,1H2/b6-3+/t14-/m0/s1 |
| InChIKey | VEAUNWQYYMXIRB-ZRFDWSJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Metasequoia glyptostroboides (ncbitaxon:3371) | |||
| stem (BTO:0001300) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves | |
| leaf (BTO:0000713) | PubMed (21226514) | 95% ethanolic extract of air-dried, powdered stems and leaves |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-hinokiresinol (CHEBI:435764) has role metabolite (CHEBI:25212) |
| (−)-hinokiresinol (CHEBI:435764) is a 1,3-bis(p-hydroxyphenyl)pentane-1,4-diene (CHEBI:131953) |
| (−)-hinokiresinol (CHEBI:435764) is a norlignan (CHEBI:53629) |
| IUPAC Name |
|---|
| 4-[(1E,3S)-1-(4-hydroxyphenyl)penta-1,4-dien-3-yl]phenol |
| Synonym | Source |
|---|---|
| 4-[(1E,3S)-3-(4-hydroxyphenyl)penta-1,4-dienyl]phenol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00000722 | KNApSAcK |
| C10628 | KEGG COMPOUND |
| EP2323641 | Patent |
| US2009312274 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1971903 | Beilstein |
| CAS:17676-24-3 | KEGG COMPOUND |
| CAS:17676-24-3 | ChemIDplus |
| Citations |
|---|