EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22O6 |
| Net Charge | 0 |
| Average Mass | 394.423 |
| Monoisotopic Mass | 394.14164 |
| SMILES | [H][C@@]12COc3cc(OC)c(OC)cc3[C@]1([H])C(=O)c1ccc3c(c1O2)C=CC(C)(C)O3 |
| InChI | InChI=1S/C23H22O6/c1-23(2)8-7-12-15(29-23)6-5-13-21(24)20-14-9-17(25-3)18(26-4)10-16(14)27-11-19(20)28-22(12)13/h5-10,19-20H,11H2,1-4H3/t19-,20+/m1/s1 |
| InChIKey | ORDAZKGHSNRHTD-UXHICEINSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mundulea sericea (ncbitaxon:54460) | - | PubMed (9270008) | |
| Tephrosia purpurea (ncbitaxon:228354) | - | PubMed (31504284) | |
| Tephrosia vogelii (ncbitaxon:1157238) | - | PubMed (32454059) |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deguelin (CHEBI:4357) has role angiogenesis inhibitor (CHEBI:48422) |
| deguelin (CHEBI:4357) has role anti-inflammatory agent (CHEBI:67079) |
| deguelin (CHEBI:4357) has role antineoplastic agent (CHEBI:35610) |
| deguelin (CHEBI:4357) has role antiviral agent (CHEBI:22587) |
| deguelin (CHEBI:4357) has role apoptosis inducer (CHEBI:68495) |
| deguelin (CHEBI:4357) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| deguelin (CHEBI:4357) has role mitochondrial NADH:ubiquinone reductase inhibitor (CHEBI:38498) |
| deguelin (CHEBI:4357) has role plant metabolite (CHEBI:76924) |
| deguelin (CHEBI:4357) is a aromatic ether (CHEBI:35618) |
| deguelin (CHEBI:4357) is a diether (CHEBI:46786) |
| deguelin (CHEBI:4357) is a organic heteropentacyclic compound (CHEBI:38164) |
| deguelin (CHEBI:4357) is a rotenones (CHEBI:72581) |
| IUPAC Name |
|---|
| (7aS,13aS)-9,10-dimethoxy-3,3-dimethyl-13,13a-dihydro-3H-chromeno[3,4-b]pyrano[2,3-h]chromen-7(7aH)-one |
| Synonyms | Source |
|---|---|
| (7aS,13aS)-13,13a-dihydro-9,10-dimethoxy-3,3-dimethyl-3H-bis[1]benzopyrano[3,4-b:6',5'-e]pyran-7(7aH)-one | ChEBI |
| (7aS,13aS)-9,10-dimethoxy-3,3-dimethyl-13,13a-dihydro-3H-pyrano[2',3':7,8][1]benzopyrano[2,3-c][1]benzopyran-7(7aH)-one | IUPAC |
| (−)-deguelin | ChEBI |
| (−)-cis-deguelin | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| 97058 | ChemSpider |
| C00002522 | KNApSAcK |
| C10417 | KEGG COMPOUND |
| CPD-12163 | MetaCyc |
| Deguelin | Wikipedia |
| HMDB0250941 | HMDB |
| LMPK12060019 | LIPID MAPS |
| LSM-3368 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:522-17-8 | ChemIDplus |
| Citations |
|---|