EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N4O8P |
| Net Charge | 0 |
| Average Mass | 348.208 |
| Monoisotopic Mass | 348.04710 |
| SMILES | O=c1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H13N4O8P/c15-6-4(1-21-23(18,19)20)22-10(7(6)16)14-3-13-5-8(14)11-2-12-9(5)17/h2-4,6-7,10,15-16H,1H2,(H,11,12,17)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | GRSZFWQUAKGDAV-KQYNXXCUSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (7877593) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| IMP (CHEBI:17202) has role Escherichia coli metabolite (CHEBI:76971) |
| IMP (CHEBI:17202) has role human metabolite (CHEBI:77746) |
| IMP (CHEBI:17202) has role mouse metabolite (CHEBI:75771) |
| IMP (CHEBI:17202) is a inosine phosphate (CHEBI:24843) |
| IMP (CHEBI:17202) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| IMP (CHEBI:17202) is conjugate acid of IMP(2−) (CHEBI:58053) |
| Incoming Relation(s) |
| 2'-deoxyinosine-5'-diphosphate (CHEBI:28823) has functional parent IMP (CHEBI:17202) |
| 2'-deoxyinosine-5'-monophosphate (CHEBI:28806) has functional parent IMP (CHEBI:17202) |
| IMP(2−) (CHEBI:58053) is conjugate base of IMP (CHEBI:17202) |
| IMP residue (CHEBI:76778) is substituent group from IMP (CHEBI:17202) |
| IUPAC Name |
|---|
| 5'-inosinic acid |
| Synonyms | Source |
|---|---|
| 2'-inosine-5'-monophosphate | ChEBI |
| 5'-IMP | KEGG COMPOUND |
| 5'-Inosinate | KEGG COMPOUND |
| 5'-Inosine monophosphate | KEGG COMPOUND |
| 5'-Inosinic acid | KEGG COMPOUND |
| hypoxanthosine 5'-monophosphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00007224 | KNApSAcK |
| C00130 | KEGG COMPOUND |
| DB04566 | DrugBank |
| HMDB0000175 | HMDB |
| IMP | MetaCyc |
| IMP | PDBeChem |
| Inosinic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Gmelin:528845 | Gmelin |
| Reaxys:630517 | Reaxys |
| CAS:131-99-7 | KEGG COMPOUND |
| CAS:131-99-7 | ChemIDplus |
| Citations |
|---|