EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H48O10 |
| Net Charge | 0 |
| Average Mass | 592.726 |
| Monoisotopic Mass | 592.32475 |
| SMILES | [H][C@]1([C@@H](C)CC[C@H](OC)c2cccc(O)c2)O[C@@]23CC(OC(=O)C[C@]([H])([C@@H](C)O)OC(=O)C[C@](O)(O2)[C@H](C)CC3(C)C)[C@@H]1C |
| InChI | InChI=1S/C32H48O10/c1-18(11-12-24(38-7)22-9-8-10-23(34)13-22)29-20(3)26-16-32(41-29)30(5,6)15-19(2)31(37,42-32)17-28(36)39-25(21(4)33)14-27(35)40-26/h8-10,13,18-21,24-26,29,33-34,37H,11-12,14-17H2,1-7H3/t18-,19+,20-,21+,24-,25+,26?,29+,31-,32-/m0/s1 |
| InChIKey | REAZZDPREXHWNV-BUNNSNHRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gracilaria coronopifolia (ncbitaxon:439548) | - | PubMed (8843576) | |
| Lyngbya majuscula (ncbitaxon:158786) | - | PubMed (3924698) | |
| Moorea producens (ncbitaxon:1155739) | - | PubMed (25421266) | |
| Stylocheilus longicauda (ncbitaxon:114761) | - | PubMed (4833645) | |
| Trichodesmium erythraeum (ncbitaxon:1206) | - | PubMed (24394406) |
| Roles Classification |
|---|
| Biological Roles: | protein kinase C agonist An agonist that selectively binds to and activates a protein kinase C receptor carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. cyanotoxin Any toxin produced by cyanobacteria (blue-green algae). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| debromoaplysiatoxin (CHEBI:4344) has role algal metabolite (CHEBI:84735) |
| debromoaplysiatoxin (CHEBI:4344) has role carcinogenic agent (CHEBI:50903) |
| debromoaplysiatoxin (CHEBI:4344) has role cyanotoxin (CHEBI:88048) |
| debromoaplysiatoxin (CHEBI:4344) has role marine metabolite (CHEBI:76507) |
| debromoaplysiatoxin (CHEBI:4344) has role protein kinase C agonist (CHEBI:64018) |
| debromoaplysiatoxin (CHEBI:4344) is a aplysiatoxins (CHEBI:88051) |
| debromoaplysiatoxin (CHEBI:4344) is a cyclic hemiketal (CHEBI:59780) |
| debromoaplysiatoxin (CHEBI:4344) is a ether (CHEBI:25698) |
| debromoaplysiatoxin (CHEBI:4344) is a organic heterotricyclic compound (CHEBI:26979) |
| debromoaplysiatoxin (CHEBI:4344) is a phenols (CHEBI:33853) |
| debromoaplysiatoxin (CHEBI:4344) is a secondary alcohol (CHEBI:35681) |
| debromoaplysiatoxin (CHEBI:4344) is a spiroketal (CHEBI:72600) |
| Synonyms | Source |
|---|---|
| 17-debromoaplysiatoxin | ChEBI |
| (1S,3R,4S,9R,13S,14R)-13-hydroxy-9-[(1R)-1-hydroxyethyl]-3-[(2S,5S)-5-(3-hydroxyphenyl)-5-methoxypentan-2-yl]-4,14,16,16-tetramethyl-2,6,10,17-tetraoxatricyclo[11.3.1.11,5]octadecane-7,11-dione | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4624539 | Reaxys |
| CAS:52423-28-6 | ChemIDplus |
| CAS:52423-28-6 | KEGG COMPOUND |
| Citations |
|---|