EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)[C@@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2121A-1a_1-5]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2-,3+,4+,6+/m0/s1 |
| InChIKey | AEMOLEFTQBMNLQ-VCSGLWQLSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-L-iduronic acid (CHEBI:43394) is a L-idopyranuronic acid (CHEBI:47903) |
| α-L-iduronic acid (CHEBI:43394) is conjugate acid of α-L-iduronate (CHEBI:193037) |
| Incoming Relation(s) |
| α-L-IdopA-(1→3)-2,5-anhydro-D-Glc-OH4S (CHEBI:152304) has functional parent α-L-iduronic acid (CHEBI:43394) |
| α-L-IdopA-(1→3)-β-D-GalpNAc4S (CHEBI:145592) has functional parent α-L-iduronic acid (CHEBI:43394) |
| α-L-iduronate (CHEBI:193037) is conjugate base of α-L-iduronic acid (CHEBI:43394) |
| IUPAC Name |
|---|
| α-L-idopyranuronic acid |
| Synonym | Source |
|---|---|
| L-IDURONIC ACID | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| IDR | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22923501 | Reaxys |