EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO2 |
| Net Charge | 0 |
| Average Mass | 145.202 |
| Monoisotopic Mass | 145.11028 |
| SMILES | CC[C@H](C)[C@H](NC)C(=O)O |
| InChI | InChI=1S/C7H15NO2/c1-4-5(2)6(8-3)7(9)10/h5-6,8H,4H2,1-3H3,(H,9,10)/t5-,6-/m0/s1 |
| InChIKey | KSPIYJQBLVDRRI-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-L-isoleucine (CHEBI:43312) is a N-methyl-L-α-amino acid (CHEBI:21752) |
| N-methyl-L-isoleucine (CHEBI:43312) is a N-methylisoleucine (CHEBI:64350) |
| IUPAC Name |
|---|
| N-methyl-L-isoleucine |
| Synonyms | Source |
|---|---|
| (2S,3S)-3-methyl-2-methylaminopentanoic acid | PDBeChem |
| MeIle | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| IML | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722062 | Reaxys |
| Citations |
|---|